C23H18Cl2N2OS — CID 4057227
6-(2,4-dichlorophenyl)-9-thiophen-2-yl-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 4057227) has the molecular formula C23H18Cl2N2OS and a molecular weight of 441.38 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-9-thiophen-2-yl-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(2,4-dichlorophenyl)-9-thiophen-2-yl-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 4057227 |
| Molecular Formula | C23H18Cl2N2OS |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-9-thiophen-2-yl-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | O=C1CC(c2cccs2)C=C2Nc3ccccc3NC(c3ccc(Cl)cc3Cl)C12 |
| InChI | InChI=1S/C23H18Cl2N2OS/c24-14-7-8-15(16(25)12-14)23-22-19(26-17-4-1-2-5-18(17)27-23)10-13(11-20(22)28)21-6-3-9-29-21/h1-10,12-13,22-23,26-27H,11H2 |
| InChIKey | FJWSIPFHNLJCLN-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |