C26H20Cl2N2O3 — CID 4754203
6-(6-chloro-1,3-benzodioxol-5-yl)-9-(4-chlorophenyl)-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 4754203) has the molecular formula C26H20Cl2N2O3 and a molecular weight of 479.36 g/mol. Its IUPAC name is 6-(6-chloro-1,3-benzodioxol-5-yl)-9-(4-chlorophenyl)-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 6-(6-chloro-1,3-benzodioxol-5-yl)-9-(4-chlorophenyl)-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 4754203 |
| Molecular Formula | C26H20Cl2N2O3 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 6-(6-chloro-1,3-benzodioxol-5-yl)-9-(4-chlorophenyl)-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | O=C1CC(c2ccc(Cl)cc2)C=C2Nc3ccccc3NC(c3cc4c(cc3Cl)OCO4)C12 |
| InChI | InChI=1S/C26H20Cl2N2O3/c27-16-7-5-14(6-8-16)15-9-21-25(22(31)10-15)26(30-20-4-2-1-3-19(20)29-21)17-11-23-24(12-18(17)28)33-13-32-23/h1-9,11-12,15,25-26,29-30H,10,13H2 |
| InChIKey | GCJNUXIJTRTGEL-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |