C24H21ClN2OS — CID 5222718
9-(2-chlorophenyl)-6-(5-methylthiophen-2-yl)-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one (PubChem CID 5222718) has the molecular formula C24H21ClN2OS and a molecular weight of 420.97 g/mol. Its IUPAC name is 9-(2-chlorophenyl)-6-(5-methylthiophen-2-yl)-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one.
| Compound Name | 9-(2-chlorophenyl)-6-(5-methylthiophen-2-yl)-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 5222718 |
| Molecular Formula | C24H21ClN2OS |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 9-(2-chlorophenyl)-6-(5-methylthiophen-2-yl)-5,6,6a,8,9,11-hexahydrobenzo[b][1,4]benzodiazepin-7-one |
| SMILES | Cc1ccc(C2Nc3ccccc3NC3=CC(c4ccccc4Cl)CC(=O)C32)s1 |
| InChI | InChI=1S/C24H21ClN2OS/c1-14-10-11-22(29-14)24-23-20(26-18-8-4-5-9-19(18)27-24)12-15(13-21(23)28)16-6-2-3-7-17(16)25/h2-12,15,23-24,26-27H,13H2,1H3 |
| InChIKey | ZWEADDDHKMJOPH-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |