C22H19N3O — CID 40573364
cis-(1R,2S)-2-phenyl-N-[(Z)-[phenyl(pyridin-3-yl)methylidene]amino]cyclopropane-1-carboxamide (PubChem CID 40573364) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is cis-(1R,2S)-2-phenyl-N-[(Z)-[phenyl(pyridin-3-yl)methylidene]amino]cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-phenyl-N-[(Z)-[phenyl(pyridin-3-yl)methylidene]amino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 40573364 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | cis-(1R,2S)-2-phenyl-N-[(Z)-[phenyl(pyridin-3-yl)methylidene]amino]cyclopropane-1-carboxamide |
| SMILES | O=C(N/N=C(/c1ccccc1)c1cccnc1)[C@@H]1C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C22H19N3O/c26-22(20-14-19(20)16-8-3-1-4-9-16)25-24-21(17-10-5-2-6-11-17)18-12-7-13-23-15-18/h1-13,15,19-20H,14H2,(H,25,26)/b24-21-/t19-,20-/m1/s1 |
| InChIKey | QJWSRPGCTHQLEV-ZHOVJFMPSA-N |
| XLogP | 3.75 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|