C18H20N2OS — CID 40585229
cis-(1R,2S)-N-[(Z)-1-(5-ethylthiophen-2-yl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide (PubChem CID 40585229) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is cis-(1R,2S)-N-[(Z)-1-(5-ethylthiophen-2-yl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-N-[(Z)-1-(5-ethylthiophen-2-yl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 40585229 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | cis-(1R,2S)-N-[(Z)-1-(5-ethylthiophen-2-yl)ethylideneamino]-2-phenylcyclopropane-1-carboxamide |
| SMILES | CCc1ccc(/C(C)=N\NC(=O)[C@@H]2C[C@@H]2c2ccccc2)s1 |
| InChI | InChI=1S/C18H20N2OS/c1-3-14-9-10-17(22-14)12(2)19-20-18(21)16-11-15(16)13-7-5-4-6-8-13/h4-10,15-16H,3,11H2,1-2H3,(H,20,21)/b19-12-/t15-,16-/m1/s1 |
| InChIKey | OCBIEMRNZSMHHY-OJTJRJJXSA-N |
| XLogP | 3.95 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|