C23H18FeN2O2 — CID 4059934
cyclopenta-1,3-diene;N-(4-cyclopenta-1,3-dien-1-ylphenyl)-1-(3-nitrophenyl)methanimine;iron(2+) (PubChem CID 4059934) has the molecular formula C23H18FeN2O2 and a molecular weight of 410.25 g/mol. Its IUPAC name is cyclopenta-1,3-diene;N-(4-cyclopenta-1,3-dien-1-ylphenyl)-1-(3-nitrophenyl)methanimine;iron(2+).
| Compound Name | cyclopenta-1,3-diene;N-(4-cyclopenta-1,3-dien-1-ylphenyl)-1-(3-nitrophenyl)methanimine;iron(2+) |
|---|---|
| PubChem CID | 4059934 |
| Molecular Formula | C23H18FeN2O2 |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | cyclopenta-1,3-diene;N-(4-cyclopenta-1,3-dien-1-ylphenyl)-1-(3-nitrophenyl)methanimine;iron(2+) |
| SMILES | O=[N+]([O-])c1cccc(/C=N/c2ccc(-c3ccc[cH-]3)cc2)c1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C18H13N2O2.C5H5.Fe/c21-20(22)18-7-3-4-14(12-18)13-19-17-10-8-16(9-11-17)15-5-1-2-6-15;1-2-4-5-3-1;/h1-13H;1-5H;/q2*-1;+2/b19-13+;; |
| InChIKey | YDOCQRDBZPRSLE-BWSKXRJVSA-N |
| XLogP | 6.13 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|