C15H17N5O3 — CID 4060137
3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N'-(2-phenylprop-1-enyl)propanehydrazide (PubChem CID 4060137) has the molecular formula C15H17N5O3 and a molecular weight of 315.33 g/mol. Its IUPAC name is 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N'-(2-phenylprop-1-enyl)propanehydrazide.
| Compound Name | 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N'-(2-phenylprop-1-enyl)propanehydrazide |
|---|---|
| PubChem CID | 4060137 |
| Molecular Formula | C15H17N5O3 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 3-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N'-(2-phenylprop-1-enyl)propanehydrazide |
| SMILES | CC(=CNNC(=O)CCc1n[nH]c(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C15H17N5O3/c1-10(11-5-3-2-4-6-11)9-16-19-13(21)8-7-12-14(22)17-15(23)20-18-12/h2-6,9,16H,7-8H2,1H3,(H,19,21)(H2,17,20,22,23) |
| InChIKey | JUWYQCKCQXIGGY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 119.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|