C14H15N5O3 — CID 7066044
2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[[(2S)-2-phenylpropylidene]amino]acetamide (PubChem CID 7066044) has the molecular formula C14H15N5O3 and a molecular weight of 301.31 g/mol. Its IUPAC name is 2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[[(2S)-2-phenylpropylidene]amino]acetamide.
| Compound Name | 2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[[(2S)-2-phenylpropylidene]amino]acetamide |
|---|---|
| PubChem CID | 7066044 |
| Molecular Formula | C14H15N5O3 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-(3,5-dioxo-2H-1,2,4-triazin-6-yl)-N-[[(2S)-2-phenylpropylidene]amino]acetamide |
| SMILES | C[C@H](C=NNC(=O)Cc1n[nH]c(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C14H15N5O3/c1-9(10-5-3-2-4-6-10)8-15-18-12(20)7-11-13(21)16-14(22)19-17-11/h2-6,8-9H,7H2,1H3,(H,18,20)(H2,16,19,21,22)/t9-/m1/s1 |
| InChIKey | BTGVICNJGAJACK-SECBINFHSA-N |
| XLogP | -0.09 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|