C15H13Cl3N2O2 — CID 40605805
N-[(E)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 40605805) has the molecular formula C15H13Cl3N2O2 and a molecular weight of 359.64 g/mol. Its IUPAC name is N-[(E)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(E)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 40605805 |
| Molecular Formula | C15H13Cl3N2O2 |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | N-[(E)-[(1R,5S)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)N/N=C1\C[C@@H]2C=CC[C@H]12 |
| InChI | InChI=1S/C15H13Cl3N2O2/c16-10-5-12(18)14(6-11(10)17)22-7-15(21)20-19-13-4-8-2-1-3-9(8)13/h1-2,5-6,8-9H,3-4,7H2,(H,20,21)/b19-13+/t8-,9-/m0/s1 |
| InChIKey | ZRBLUIHJUAHIPS-ZHNLUVCDSA-N |
| XLogP | 4.09 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|