C14H15Cl3N2O2 — CID 5062453
N-(cyclohexylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 5062453) has the molecular formula C14H15Cl3N2O2 and a molecular weight of 349.65 g/mol. Its IUPAC name is N-(cyclohexylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-(cyclohexylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 5062453 |
| Molecular Formula | C14H15Cl3N2O2 |
| Molecular Weight | 349.65 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | N-(cyclohexylideneamino)-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)c(Cl)cc1Cl)NN=C1CCCCC1 |
| InChI | InChI=1S/C14H15Cl3N2O2/c15-10-6-12(17)13(7-11(10)16)21-8-14(20)19-18-9-4-2-1-3-5-9/h6-7H,1-5,8H2,(H,19,20) |
| InChIKey | KXQJOJSRZONPNG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|