C21H23N3O4 — CID 40607430
N-(6-acetamido-1,3-benzoxazol-2-yl)-2-[4-[(2S)-butan-2-yl]phenoxy]acetamide (PubChem CID 40607430) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-(6-acetamido-1,3-benzoxazol-2-yl)-2-[4-[(2S)-butan-2-yl]phenoxy]acetamide.
| Compound Name | N-(6-acetamido-1,3-benzoxazol-2-yl)-2-[4-[(2S)-butan-2-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 40607430 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-(6-acetamido-1,3-benzoxazol-2-yl)-2-[4-[(2S)-butan-2-yl]phenoxy]acetamide |
| SMILES | CC[C@H](C)c1ccc(OCC(=O)Nc2nc3ccc(NC(C)=O)cc3o2)cc1 |
| InChI | InChI=1S/C21H23N3O4/c1-4-13(2)15-5-8-17(9-6-15)27-12-20(26)24-21-23-18-10-7-16(22-14(3)25)11-19(18)28-21/h5-11,13H,4,12H2,1-3H3,(H,22,25)(H,23,24,26)/t13-/m0/s1 |
| InChIKey | ULKMGNZBRGNDGR-ZDUSSCGKSA-N |
| XLogP | 4.32 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |