C23H30N6O — CID 40612356
cis-(1R,3R)-3-(1H-benzimidazol-2-yl)-N-[(Z)-(1-ethyl-3-methylpyrazol-4-yl)methylideneamino]-1,2,2-trimethylcyclopentane-1-carboxamide (PubChem CID 40612356) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is cis-(1R,3R)-3-(1H-benzimidazol-2-yl)-N-[(Z)-(1-ethyl-3-methylpyrazol-4-yl)methylideneamino]-1,2,2-trimethylcyclopentane-1-carboxamide.
| Compound Name | cis-(1R,3R)-3-(1H-benzimidazol-2-yl)-N-[(Z)-(1-ethyl-3-methylpyrazol-4-yl)methylideneamino]-1,2,2-trimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 40612356 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | cis-(1R,3R)-3-(1H-benzimidazol-2-yl)-N-[(Z)-(1-ethyl-3-methylpyrazol-4-yl)methylideneamino]-1,2,2-trimethylcyclopentane-1-carboxamide |
| SMILES | CCn1cc(/C=N\NC(=O)[C@]2(C)CC[C@@H](c3nc4ccccc4[nH]3)C2(C)C)c(C)n1 |
| InChI | InChI=1S/C23H30N6O/c1-6-29-14-16(15(2)28-29)13-24-27-21(30)23(5)12-11-17(22(23,3)4)20-25-18-9-7-8-10-19(18)26-20/h7-10,13-14,17H,6,11-12H2,1-5H3,(H,25,26)(H,27,30)/b24-13-/t17-,23-/m0/s1 |
| InChIKey | ZXFKLBONABWTEJ-GRNJFCEASA-N |
| XLogP | 4.15 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|