C24H32N6O — CID 4775244
3-(1H-benzimidazol-2-yl)-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-1,2,2-trimethylcyclopentane-1-carboxamide (PubChem CID 4775244) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-1,2,2-trimethylcyclopentane-1-carboxamide.
| Compound Name | 3-(1H-benzimidazol-2-yl)-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-1,2,2-trimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 4775244 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-N-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methylideneamino]-1,2,2-trimethylcyclopentane-1-carboxamide |
| SMILES | CCn1nc(C)c(C=NNC(=O)C2(C)CCC(c3nc4ccccc4[nH]3)C2(C)C)c1C |
| InChI | InChI=1S/C24H32N6O/c1-7-30-16(3)17(15(2)29-30)14-25-28-22(31)24(6)13-12-18(23(24,4)5)21-26-19-10-8-9-11-20(19)27-21/h8-11,14,18H,7,12-13H2,1-6H3,(H,26,27)(H,28,31) |
| InChIKey | AWJHYTHROTZWFF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|