C23H25FN4O — CID 129438491
cis-(1S,3S)-3-(1H-benzimidazol-2-yl)-N-[(3-fluorophenyl)methylideneamino]-1,2,2-trimethylcyclopentane-1-carboxamide (PubChem CID 129438491) has the molecular formula C23H25FN4O and a molecular weight of 392.48 g/mol. Its IUPAC name is cis-(1S,3S)-3-(1H-benzimidazol-2-yl)-N-[(3-fluorophenyl)methylideneamino]-1,2,2-trimethylcyclopentane-1-carboxamide.
| Compound Name | cis-(1S,3S)-3-(1H-benzimidazol-2-yl)-N-[(3-fluorophenyl)methylideneamino]-1,2,2-trimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 129438491 |
| Molecular Formula | C23H25FN4O |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | cis-(1S,3S)-3-(1H-benzimidazol-2-yl)-N-[(3-fluorophenyl)methylideneamino]-1,2,2-trimethylcyclopentane-1-carboxamide |
| SMILES | CC1(C)[C@@H](c2nc3ccccc3[nH]2)CC[C@]1(C)C(=O)NN=Cc1cccc(F)c1 |
| InChI | InChI=1S/C23H25FN4O/c1-22(2)17(20-26-18-9-4-5-10-19(18)27-20)11-12-23(22,3)21(29)28-25-14-15-7-6-8-16(24)13-15/h4-10,13-14,17H,11-12H2,1-3H3,(H,26,27)(H,28,29)/t17-,23-/m1/s1 |
| InChIKey | GRCDWLIMBGBCGC-UZUQRXQVSA-N |
| XLogP | 4.76 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|