C22H25ClN3O2+ — CID 4061722
5-chloro-8-methoxy-2-methyl-3-[(4-phenylpiperazin-1-ium-1-yl)methyl]-1H-quinolin-4-one (PubChem CID 4061722) has the molecular formula C22H25ClN3O2+ and a molecular weight of 398.91 g/mol. Its IUPAC name is 5-chloro-8-methoxy-2-methyl-3-[(4-phenylpiperazin-1-ium-1-yl)methyl]-1H-quinolin-4-one.
| Compound Name | 5-chloro-8-methoxy-2-methyl-3-[(4-phenylpiperazin-1-ium-1-yl)methyl]-1H-quinolin-4-one |
|---|---|
| PubChem CID | 4061722 |
| Molecular Formula | C22H25ClN3O2+ |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 5-chloro-8-methoxy-2-methyl-3-[(4-phenylpiperazin-1-ium-1-yl)methyl]-1H-quinolin-4-one |
| SMILES | COc1ccc(Cl)c2c(=O)c(C[NH+]3CCN(c4ccccc4)CC3)c(C)[nH]c12 |
| InChI | InChI=1S/C22H24ClN3O2/c1-15-17(22(27)20-18(23)8-9-19(28-2)21(20)24-15)14-25-10-12-26(13-11-25)16-6-4-3-5-7-16/h3-9H,10-14H2,1-2H3,(H,24,27)/p+1 |
| InChIKey | FGLMKWNRKPJXFE-UHFFFAOYSA-O |
| XLogP | 2.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |