C16H24N4O5S — CID 40617502
2-[[(4S)-4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]sulfanyl]-1,3-dimorpholin-4-ylpropane-1,3-dione (PubChem CID 40617502) has the molecular formula C16H24N4O5S and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-[[(4S)-4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]sulfanyl]-1,3-dimorpholin-4-ylpropane-1,3-dione.
| Compound Name | 2-[[(4S)-4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]sulfanyl]-1,3-dimorpholin-4-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 40617502 |
| Molecular Formula | C16H24N4O5S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[[(4S)-4-methyl-6-oxo-4,5-dihydro-1H-pyrimidin-2-yl]sulfanyl]-1,3-dimorpholin-4-ylpropane-1,3-dione |
| SMILES | C[C@H]1CC(=O)NC(SC(C(=O)N2CCOCC2)C(=O)N2CCOCC2)=N1 |
| InChI | InChI=1S/C16H24N4O5S/c1-11-10-12(21)18-16(17-11)26-13(14(22)19-2-6-24-7-3-19)15(23)20-4-8-25-9-5-20/h11,13H,2-10H2,1H3,(H,17,18,21)/t11-/m0/s1 |
| InChIKey | PWJIEALVAXXWRZ-NSHDSACASA-N |
| XLogP | -0.93 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|