C13H19N5O4S — CID 3600623
1,3-dimorpholin-4-yl-2-(1H-1,2,4-triazol-5-ylsulfanyl)propane-1,3-dione (PubChem CID 3600623) has the molecular formula C13H19N5O4S and a molecular weight of 341.39 g/mol. Its IUPAC name is 1,3-dimorpholin-4-yl-2-(1H-1,2,4-triazol-5-ylsulfanyl)propane-1,3-dione.
| Compound Name | 1,3-dimorpholin-4-yl-2-(1H-1,2,4-triazol-5-ylsulfanyl)propane-1,3-dione |
|---|---|
| PubChem CID | 3600623 |
| Molecular Formula | C13H19N5O4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 1,3-dimorpholin-4-yl-2-(1H-1,2,4-triazol-5-ylsulfanyl)propane-1,3-dione |
| SMILES | O=C(C(Sc1ncn[nH]1)C(=O)N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C13H19N5O4S/c19-11(17-1-5-21-6-2-17)10(23-13-14-9-15-16-13)12(20)18-3-7-22-8-4-18/h9-10H,1-8H2,(H,14,15,16) |
| InChIKey | RNISXPDGMLJFAS-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|