C26H21N4O+ — CID 4062991
2-[2-(4-methoxyphenyl)ethenyl]-1,3-dipyridin-2-ylbenzimidazol-3-ium (PubChem CID 4062991) has the molecular formula C26H21N4O+ and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)ethenyl]-1,3-dipyridin-2-ylbenzimidazol-3-ium.
| Compound Name | 2-[2-(4-methoxyphenyl)ethenyl]-1,3-dipyridin-2-ylbenzimidazol-3-ium |
|---|---|
| PubChem CID | 4062991 |
| Molecular Formula | C26H21N4O+ |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)ethenyl]-1,3-dipyridin-2-ylbenzimidazol-3-ium |
| SMILES | COc1ccc(C=Cc2n(-c3ccccn3)c3ccccc3[n+]2-c2ccccn2)cc1 |
| InChI | InChI=1S/C26H21N4O/c1-31-21-15-12-20(13-16-21)14-17-26-29(24-10-4-6-18-27-24)22-8-2-3-9-23(22)30(26)25-11-5-7-19-28-25/h2-19H,1H3/q+1 |
| InChIKey | FEPCPMZZDLWYTL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|