C24H22N2O2S — CID 40634821
N-[2-(1,3-benzothiazol-2-yl)phenyl]-3-[(2R)-butan-2-yl]oxybenzamide (PubChem CID 40634821) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)phenyl]-3-[(2R)-butan-2-yl]oxybenzamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-3-[(2R)-butan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 40634821 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)phenyl]-3-[(2R)-butan-2-yl]oxybenzamide |
| SMILES | CC[C@@H](C)Oc1cccc(C(=O)Nc2ccccc2-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C24H22N2O2S/c1-3-16(2)28-18-10-8-9-17(15-18)23(27)25-20-12-5-4-11-19(20)24-26-21-13-6-7-14-22(21)29-24/h4-16H,3H2,1-2H3,(H,25,27)/t16-/m1/s1 |
| InChIKey | ZAUSSRDSJXCJHP-MRXNPFEDSA-N |
| XLogP | 6.39 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |