About 4-chloro-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-1-methylpyrazole-5-carboxamide
4-chloro-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-1-methylpyrazole-5-carboxamide (PubChem CID 40635795) has the molecular formula C15H18ClN3O
and a molecular weight of 291.78 g/mol. Its IUPAC name is 4-chloro-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-1-methylpyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-1-methylpyrazole-5-carboxamide |
| PubChem CID | 40635795 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 4-chloro-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-1-methylpyrazole-5-carboxamide |
| SMILES | Cc1ccc([C@@H](C)NC(=O)c2c(Cl)cnn2C)cc1C |
| InChI | InChI=1S/C15H18ClN3O/c1-9-5-6-12(7-10(9)2)11(3)18-15(20)14-13(16)8-17-19(14)4/h5-8,11H,1-4H3,(H,18,20)/t11-/m1/s1 |
| InChIKey | IVNDNSPHGFMPLI-LLVKDONJSA-N |
| XLogP | 3.18 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-1-methylpyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-1-methylpyrazole-5-carboxamide?
The IUPAC name of 4-chloro-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-1-methylpyrazole-5-carboxamide (CID 40635795) is 4-chloro-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-1-methylpyrazole-5-carboxamide.
What is the SMILES notation for 4-chloro-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-1-methylpyrazole-5-carboxamide?
The canonical SMILES for 4-chloro-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-1-methylpyrazole-5-carboxamide is Cc1ccc([C@@H](C)NC(=O)c2c(Cl)cnn2C)cc1C.
What is the InChIKey of 4-chloro-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-1-methylpyrazole-5-carboxamide?
The InChIKey is IVNDNSPHGFMPLI-LLVKDONJSA-N. The full InChI is InChI=1S/C15H18ClN3O/c1-9-5-6-12(7-10(9)2)11(3)18-15(20)14-13(16)8-17-19(14)4/h5-8,11H,1-4H3,(H,18,20)/t11-/m1/s1.
What are the key properties of 4-chloro-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-1-methylpyrazole-5-carboxamide?
4-chloro-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-1-methylpyrazole-5-carboxamide has a molecular weight of 291.78 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(1R)-1-(3,4-dimethylphenyl)ethyl]-1-methylpyrazole-5-carboxamide is sourced from PubChem (CID 40635795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).