C13H21NO2S — CID 40641504
ethyl (3R,5R,7aS)-5-(2-methylprop-2-enyl)-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 40641504) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is ethyl (3R,5R,7aS)-5-(2-methylprop-2-enyl)-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | ethyl (3R,5R,7aS)-5-(2-methylprop-2-enyl)-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 40641504 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | ethyl (3R,5R,7aS)-5-(2-methylprop-2-enyl)-2,3,5,6,7,7a-hexahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | C=C(C)C[C@H]1CC[C@@H]2SC[C@@H](C(=O)OCC)N12 |
| InChI | InChI=1S/C13H21NO2S/c1-4-16-13(15)11-8-17-12-6-5-10(14(11)12)7-9(2)3/h10-12H,2,4-8H2,1,3H3/t10-,11+,12+/m1/s1 |
| InChIKey | GRJAJZDYXXXWKP-WOPDTQHZSA-N |
| XLogP | 2.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|