C21H21NO4 — CID 40653349
(2S)-2-(4,7-dimethyl-2-oxochromen-6-yl)oxy-N-(4-methylphenyl)propanamide (PubChem CID 40653349) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is (2S)-2-(4,7-dimethyl-2-oxochromen-6-yl)oxy-N-(4-methylphenyl)propanamide.
| Compound Name | (2S)-2-(4,7-dimethyl-2-oxochromen-6-yl)oxy-N-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 40653349 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (2S)-2-(4,7-dimethyl-2-oxochromen-6-yl)oxy-N-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)[C@H](C)Oc2cc3c(C)cc(=O)oc3cc2C)cc1 |
| InChI | InChI=1S/C21H21NO4/c1-12-5-7-16(8-6-12)22-21(24)15(4)25-18-11-17-13(2)10-20(23)26-19(17)9-14(18)3/h5-11,15H,1-4H3,(H,22,24)/t15-/m0/s1 |
| InChIKey | TXWIMNKFEIRVKY-HNNXBMFYSA-N |
| XLogP | 4.12 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|