C16H19Cl2N3O2S — CID 40653595
3-[3-(2,4-dichlorophenoxy)propyl]-4-[[(2R)-oxolan-2-yl]methyl]-1H-1,2,4-triazole-5-thione (PubChem CID 40653595) has the molecular formula C16H19Cl2N3O2S and a molecular weight of 388.32 g/mol. Its IUPAC name is 3-[3-(2,4-dichlorophenoxy)propyl]-4-[[(2R)-oxolan-2-yl]methyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[3-(2,4-dichlorophenoxy)propyl]-4-[[(2R)-oxolan-2-yl]methyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 40653595 |
| Molecular Formula | C16H19Cl2N3O2S |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 3-[3-(2,4-dichlorophenoxy)propyl]-4-[[(2R)-oxolan-2-yl]methyl]-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(CCCOc2ccc(Cl)cc2Cl)n1C[C@H]1CCCO1 |
| InChI | InChI=1S/C16H19Cl2N3O2S/c17-11-5-6-14(13(18)9-11)23-8-2-4-15-19-20-16(24)21(15)10-12-3-1-7-22-12/h5-6,9,12H,1-4,7-8,10H2,(H,20,24)/t12-/m1/s1 |
| InChIKey | VVBFDBCSPARWRW-GFCCVEGCSA-N |
| XLogP | 4.44 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|