C24H36N2O2 — CID 4067375
3,6-dioctoxybenzene-1,2-dicarbonitrile (PubChem CID 4067375) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is 3,6-dioctoxybenzene-1,2-dicarbonitrile.
| Compound Name | 3,6-dioctoxybenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 4067375 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 3,6-dioctoxybenzene-1,2-dicarbonitrile |
| SMILES | CCCCCCCCOc1ccc(OCCCCCCCC)c(C#N)c1C#N |
| InChI | InChI=1S/C24H36N2O2/c1-3-5-7-9-11-13-17-27-23-15-16-24(22(20-26)21(23)19-25)28-18-14-12-10-8-6-4-2/h15-16H,3-14,17-18H2,1-2H3 |
| InChIKey | GKGPSCRTAALNMD-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|