C18H19N3O5S — CID 40687985
2-[(2,3-dimethyl-5-nitrophenyl)sulfonylamino]-N-prop-2-enylbenzamide (PubChem CID 40687985) has the molecular formula C18H19N3O5S and a molecular weight of 389.43 g/mol. Its IUPAC name is 2-[(2,3-dimethyl-5-nitrophenyl)sulfonylamino]-N-prop-2-enylbenzamide.
| Compound Name | 2-[(2,3-dimethyl-5-nitrophenyl)sulfonylamino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 40687985 |
| Molecular Formula | C18H19N3O5S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2-[(2,3-dimethyl-5-nitrophenyl)sulfonylamino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccccc1NS(=O)(=O)c1cc([N+](=O)[O-])cc(C)c1C |
| InChI | InChI=1S/C18H19N3O5S/c1-4-9-19-18(22)15-7-5-6-8-16(15)20-27(25,26)17-11-14(21(23)24)10-12(2)13(17)3/h4-8,10-11,20H,1,9H2,2-3H3,(H,19,22) |
| InChIKey | DUXMKOLGWAACFG-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|