C19H21N2O5S- — CID 7516664
3,4-dimethyl-5-[[2-(propylcarbamoyl)phenyl]sulfamoyl]benzoate (PubChem CID 7516664) has the molecular formula C19H21N2O5S- and a molecular weight of 389.45 g/mol. Its IUPAC name is 3,4-dimethyl-5-[[2-(propylcarbamoyl)phenyl]sulfamoyl]benzoate.
| Compound Name | 3,4-dimethyl-5-[[2-(propylcarbamoyl)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 7516664 |
| Molecular Formula | C19H21N2O5S- |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 3,4-dimethyl-5-[[2-(propylcarbamoyl)phenyl]sulfamoyl]benzoate |
| SMILES | CCCNC(=O)c1ccccc1NS(=O)(=O)c1cc(C(=O)[O-])cc(C)c1C |
| InChI | InChI=1S/C19H22N2O5S/c1-4-9-20-18(22)15-7-5-6-8-16(15)21-27(25,26)17-11-14(19(23)24)10-12(2)13(17)3/h5-8,10-11,21H,4,9H2,1-3H3,(H,20,22)(H,23,24)/p-1 |
| InChIKey | CQAYIXIJESAZPN-UHFFFAOYSA-M |
| XLogP | 1.61 |
| TPSA | 115.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |