C14H13FN2O5S — CID 75393186
N-(2-fluoro-3-hydroxyphenyl)-2,3-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 75393186) has the molecular formula C14H13FN2O5S and a molecular weight of 340.33 g/mol. Its IUPAC name is N-(2-fluoro-3-hydroxyphenyl)-2,3-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(2-fluoro-3-hydroxyphenyl)-2,3-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 75393186 |
| Molecular Formula | C14H13FN2O5S |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-(2-fluoro-3-hydroxyphenyl)-2,3-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1cc([N+](=O)[O-])cc(S(=O)(=O)Nc2cccc(O)c2F)c1C |
| InChI | InChI=1S/C14H13FN2O5S/c1-8-6-10(17(19)20)7-13(9(8)2)23(21,22)16-11-4-3-5-12(18)14(11)15/h3-7,16,18H,1-2H3 |
| InChIKey | ZZZOAPWQQRKCCQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|