C26H23NO3 — CID 4069125
N-(2,6-diethylphenyl)-1-oxo-4-phenylisochromene-3-carboxamide (PubChem CID 4069125) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-1-oxo-4-phenylisochromene-3-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-1-oxo-4-phenylisochromene-3-carboxamide |
|---|---|
| PubChem CID | 4069125 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-(2,6-diethylphenyl)-1-oxo-4-phenylisochromene-3-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)c1oc(=O)c2ccccc2c1-c1ccccc1 |
| InChI | InChI=1S/C26H23NO3/c1-3-17-13-10-14-18(4-2)23(17)27-25(28)24-22(19-11-6-5-7-12-19)20-15-8-9-16-21(20)26(29)30-24/h5-16H,3-4H2,1-2H3,(H,27,28) |
| InChIKey | FUKGPPYBYCOXNZ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |