C23H25NO5 — CID 126479967
N-(3,3-diethoxypropyl)-1-oxo-4-phenylisochromene-3-carboxamide (PubChem CID 126479967) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-1-oxo-4-phenylisochromene-3-carboxamide.
| Compound Name | N-(3,3-diethoxypropyl)-1-oxo-4-phenylisochromene-3-carboxamide |
|---|---|
| PubChem CID | 126479967 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-(3,3-diethoxypropyl)-1-oxo-4-phenylisochromene-3-carboxamide |
| SMILES | CCOC(CCNC(=O)c1oc(=O)c2ccccc2c1-c1ccccc1)OCC |
| InChI | InChI=1S/C23H25NO5/c1-3-27-19(28-4-2)14-15-24-22(25)21-20(16-10-6-5-7-11-16)17-12-8-9-13-18(17)23(26)29-21/h5-13,19H,3-4,14-15H2,1-2H3,(H,24,25) |
| InChIKey | GUTQCKUXKKDRAQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|