C28H27NO5 — CID 20854050
N-[2-(3,4-diethoxyphenyl)ethyl]-1-oxo-4-phenylisochromene-3-carboxamide (PubChem CID 20854050) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-1-oxo-4-phenylisochromene-3-carboxamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-1-oxo-4-phenylisochromene-3-carboxamide |
|---|---|
| PubChem CID | 20854050 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-1-oxo-4-phenylisochromene-3-carboxamide |
| SMILES | CCOc1ccc(CCNC(=O)c2oc(=O)c3ccccc3c2-c2ccccc2)cc1OCC |
| InChI | InChI=1S/C28H27NO5/c1-3-32-23-15-14-19(18-24(23)33-4-2)16-17-29-27(30)26-25(20-10-6-5-7-11-20)21-12-8-9-13-22(21)28(31)34-26/h5-15,18H,3-4,16-17H2,1-2H3,(H,29,30) |
| InChIKey | HOKVMFXUZJDZSH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |