C21H25N3O2 — CID 40696755
(3R)-1-(4-ethylphenyl)-3-[2-(4-methylanilino)ethylamino]pyrrolidine-2,5-dione (PubChem CID 40696755) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is (3R)-1-(4-ethylphenyl)-3-[2-(4-methylanilino)ethylamino]pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(4-ethylphenyl)-3-[2-(4-methylanilino)ethylamino]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 40696755 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (3R)-1-(4-ethylphenyl)-3-[2-(4-methylanilino)ethylamino]pyrrolidine-2,5-dione |
| SMILES | CCc1ccc(N2C(=O)C[C@@H](NCCNc3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H25N3O2/c1-3-16-6-10-18(11-7-16)24-20(25)14-19(21(24)26)23-13-12-22-17-8-4-15(2)5-9-17/h4-11,19,22-23H,3,12-14H2,1-2H3/t19-/m1/s1 |
| InChIKey | VPYALCKGNUAWBX-LJQANCHMSA-N |
| XLogP | 2.89 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|