C16H10BrF3N2O — CID 4070259
2-(5-bromoindol-1-yl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 4070259) has the molecular formula C16H10BrF3N2O and a molecular weight of 383.17 g/mol. Its IUPAC name is 2-(5-bromoindol-1-yl)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(5-bromoindol-1-yl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 4070259 |
| Molecular Formula | C16H10BrF3N2O |
| Molecular Weight | 383.17 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | 2-(5-bromoindol-1-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(Cn1ccc2cc(Br)ccc21)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H10BrF3N2O/c17-10-1-4-13-9(7-10)5-6-22(13)8-14(23)21-12-3-2-11(18)15(19)16(12)20/h1-7H,8H2,(H,21,23) |
| InChIKey | LULNQSOTYWWZHL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.17 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|