C34H29N3O4S2 — CID 4070543
2-(1,3-benzothiazol-2-ylsulfanyl)-N-[[2-(3,4-dimethoxyphenyl)-4-(2-methylphenyl)-4H-chromen-3-yl]methylideneamino]acetamide (PubChem CID 4070543) has the molecular formula C34H29N3O4S2 and a molecular weight of 607.76 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[[2-(3,4-dimethoxyphenyl)-4-(2-methylphenyl)-4H-chromen-3-yl]methylideneamino]acetamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[[2-(3,4-dimethoxyphenyl)-4-(2-methylphenyl)-4H-chromen-3-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4070543 |
| Molecular Formula | C34H29N3O4S2 |
| Molecular Weight | 607.76 g/mol |
| Exact Mass | 607.16 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-N-[[2-(3,4-dimethoxyphenyl)-4-(2-methylphenyl)-4H-chromen-3-yl]methylideneamino]acetamide |
| SMILES | COc1ccc(C2=C(C=NNC(=O)CSc3nc4ccccc4s3)C(c3ccccc3C)c3ccccc3O2)cc1OC |
| InChI | InChI=1S/C34H29N3O4S2/c1-21-10-4-5-11-23(21)32-24-12-6-8-14-27(24)41-33(22-16-17-28(39-2)29(18-22)40-3)25(32)19-35-37-31(38)20-42-34-36-26-13-7-9-15-30(26)43-34/h4-19,32H,20H2,1-3H3,(H,37,38) |
| InChIKey | ZAEOXBGQRWWDBL-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.76 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|