C16H21N3O5S — CID 4070884
ethyl 2-[4-(4-methylpiperazine-1-carbonyl)-2-nitrophenyl]sulfanylacetate (PubChem CID 4070884) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is ethyl 2-[4-(4-methylpiperazine-1-carbonyl)-2-nitrophenyl]sulfanylacetate.
| Compound Name | ethyl 2-[4-(4-methylpiperazine-1-carbonyl)-2-nitrophenyl]sulfanylacetate |
|---|---|
| PubChem CID | 4070884 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | ethyl 2-[4-(4-methylpiperazine-1-carbonyl)-2-nitrophenyl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1ccc(C(=O)N2CCN(C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21N3O5S/c1-3-24-15(20)11-25-14-5-4-12(10-13(14)19(22)23)16(21)18-8-6-17(2)7-9-18/h4-5,10H,3,6-9,11H2,1-2H3 |
| InChIKey | TVSGVDSVADJHML-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|