C20H16ClN3OS2 — CID 40720206
2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-N-[(R)-phenyl(thiophen-2-yl)methyl]acetamide (PubChem CID 40720206) has the molecular formula C20H16ClN3OS2 and a molecular weight of 413.96 g/mol. Its IUPAC name is 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-N-[(R)-phenyl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-N-[(R)-phenyl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 40720206 |
| Molecular Formula | C20H16ClN3OS2 |
| Molecular Weight | 413.96 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 2-[(6-chloro-1H-benzimidazol-2-yl)sulfanyl]-N-[(R)-phenyl(thiophen-2-yl)methyl]acetamide |
| SMILES | O=C(CSc1nc2ccc(Cl)cc2[nH]1)N[C@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C20H16ClN3OS2/c21-14-8-9-15-16(11-14)23-20(22-15)27-12-18(25)24-19(17-7-4-10-26-17)13-5-2-1-3-6-13/h1-11,19H,12H2,(H,22,23)(H,24,25)/t19-/m1/s1 |
| InChIKey | DKWUBUJGTLVQTQ-LJQANCHMSA-N |
| XLogP | 5.28 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.96 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |