C25H19ClN2O5 — CID 4072899
4-[[3-[(3-chlorophenyl)methylcarbamoyl]-7-methoxychromen-2-ylidene]amino]benzoic acid (PubChem CID 4072899) has the molecular formula C25H19ClN2O5 and a molecular weight of 462.89 g/mol. Its IUPAC name is 4-[[3-[(3-chlorophenyl)methylcarbamoyl]-7-methoxychromen-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[3-[(3-chlorophenyl)methylcarbamoyl]-7-methoxychromen-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 4072899 |
| Molecular Formula | C25H19ClN2O5 |
| Molecular Weight | 462.89 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 4-[[3-[(3-chlorophenyl)methylcarbamoyl]-7-methoxychromen-2-ylidene]amino]benzoic acid |
| SMILES | COc1ccc2cc(C(=O)NCc3cccc(Cl)c3)/c(=N/c3ccc(C(=O)O)cc3)oc2c1 |
| InChI | InChI=1S/C25H19ClN2O5/c1-32-20-10-7-17-12-21(23(29)27-14-15-3-2-4-18(26)11-15)24(33-22(17)13-20)28-19-8-5-16(6-9-19)25(30)31/h2-13H,14H2,1H3,(H,27,29)(H,30,31)/b28-24- |
| InChIKey | VKEGGXUDYORHNK-COOPMVRXSA-N |
| XLogP | 4.96 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.89 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |