C26H21ClN2O5 — CID 4073080
4-[[3-[(3-chlorophenyl)methylcarbamoyl]-8-ethoxychromen-2-ylidene]amino]benzoic acid (PubChem CID 4073080) has the molecular formula C26H21ClN2O5 and a molecular weight of 476.92 g/mol. Its IUPAC name is 4-[[3-[(3-chlorophenyl)methylcarbamoyl]-8-ethoxychromen-2-ylidene]amino]benzoic acid.
| Compound Name | 4-[[3-[(3-chlorophenyl)methylcarbamoyl]-8-ethoxychromen-2-ylidene]amino]benzoic acid |
|---|---|
| PubChem CID | 4073080 |
| Molecular Formula | C26H21ClN2O5 |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 4-[[3-[(3-chlorophenyl)methylcarbamoyl]-8-ethoxychromen-2-ylidene]amino]benzoic acid |
| SMILES | CCOc1cccc2cc(C(=O)NCc3cccc(Cl)c3)/c(=N/c3ccc(C(=O)O)cc3)oc12 |
| InChI | InChI=1S/C26H21ClN2O5/c1-2-33-22-8-4-6-18-14-21(24(30)28-15-16-5-3-7-19(27)13-16)25(34-23(18)22)29-20-11-9-17(10-12-20)26(31)32/h3-14H,2,15H2,1H3,(H,28,30)(H,31,32)/b29-25- |
| InChIKey | KTRPBMDXNHKAKA-GNVQSUKOSA-N |
| XLogP | 5.35 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |