C27H23N2O7- — CID 4078534
4-[[3-[(3,4-dimethoxyphenyl)carbamoyl]-8-ethoxychromen-2-ylidene]amino]benzoate (PubChem CID 4078534) has the molecular formula C27H23N2O7- and a molecular weight of 487.49 g/mol. Its IUPAC name is 4-[[3-[(3,4-dimethoxyphenyl)carbamoyl]-8-ethoxychromen-2-ylidene]amino]benzoate.
| Compound Name | 4-[[3-[(3,4-dimethoxyphenyl)carbamoyl]-8-ethoxychromen-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4078534 |
| Molecular Formula | C27H23N2O7- |
| Molecular Weight | 487.49 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | 4-[[3-[(3,4-dimethoxyphenyl)carbamoyl]-8-ethoxychromen-2-ylidene]amino]benzoate |
| SMILES | CCOc1cccc2cc(C(=O)Nc3ccc(OC)c(OC)c3)/c(=N/c3ccc(C(=O)[O-])cc3)oc12 |
| InChI | InChI=1S/C27H24N2O7/c1-4-35-22-7-5-6-17-14-20(25(30)28-19-12-13-21(33-2)23(15-19)34-3)26(36-24(17)22)29-18-10-8-16(9-11-18)27(31)32/h5-15H,4H2,1-3H3,(H,28,30)(H,31,32)/p-1/b29-26- |
| InChIKey | YSCYXSDOWPAEQS-WCTVFOPTSA-M |
| XLogP | 3.70 |
| TPSA | 122.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |