C18H22ClN3O2S — CID 4076397
2-chloro-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-pentylbenzamide (PubChem CID 4076397) has the molecular formula C18H22ClN3O2S and a molecular weight of 379.91 g/mol. Its IUPAC name is 2-chloro-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-pentylbenzamide.
| Compound Name | 2-chloro-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-pentylbenzamide |
|---|---|
| PubChem CID | 4076397 |
| Molecular Formula | C18H22ClN3O2S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 2-chloro-N-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-N-pentylbenzamide |
| SMILES | CCCCCN(CC(=O)Nc1nc(C)cs1)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H22ClN3O2S/c1-3-4-7-10-22(17(24)14-8-5-6-9-15(14)19)11-16(23)21-18-20-13(2)12-25-18/h5-6,8-9,12H,3-4,7,10-11H2,1-2H3,(H,20,21,23) |
| InChIKey | FLXHMEGGIQZSHD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|