C16H11ClN2O7 — CID 40767248
[2-(2-nitroanilino)-2-oxoethyl] 7-chloro-1,3-benzodioxole-5-carboxylate (PubChem CID 40767248) has the molecular formula C16H11ClN2O7 and a molecular weight of 378.72 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] 7-chloro-1,3-benzodioxole-5-carboxylate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] 7-chloro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 40767248 |
| Molecular Formula | C16H11ClN2O7 |
| Molecular Weight | 378.72 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] 7-chloro-1,3-benzodioxole-5-carboxylate |
| SMILES | O=C(COC(=O)c1cc(Cl)c2c(c1)OCO2)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11ClN2O7/c17-10-5-9(6-13-15(10)26-8-25-13)16(21)24-7-14(20)18-11-3-1-2-4-12(11)19(22)23/h1-6H,7-8H2,(H,18,20) |
| InChIKey | XXWJNPXBWJVDFQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.72 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|