C19H14BrClN2O4S — CID 40778492
[2-(3-bromoanilino)-2-oxoethyl] 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate (PubChem CID 40778492) has the molecular formula C19H14BrClN2O4S and a molecular weight of 481.76 g/mol. Its IUPAC name is [2-(3-bromoanilino)-2-oxoethyl] 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate.
| Compound Name | [2-(3-bromoanilino)-2-oxoethyl] 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 40778492 |
| Molecular Formula | C19H14BrClN2O4S |
| Molecular Weight | 481.76 g/mol |
| Exact Mass | 479.95 |
| IUPAC Name | [2-(3-bromoanilino)-2-oxoethyl] 2-[(3-chloro-1-benzothiophene-2-carbonyl)amino]acetate |
| SMILES | O=C(COC(=O)CNC(=O)c1sc2ccccc2c1Cl)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C19H14BrClN2O4S/c20-11-4-3-5-12(8-11)23-15(24)10-27-16(25)9-22-19(26)18-17(21)13-6-1-2-7-14(13)28-18/h1-8H,9-10H2,(H,22,26)(H,23,24) |
| InChIKey | UQDVQSIYDGRXRG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.76 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |