C23H26ClN3O3S — CID 40780786
(3aR,4R,6R,7R,7aR)-N-benzyl-3-(3-chloro-4-methylphenyl)-6,7-dihydroxy-N-methyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide (PubChem CID 40780786) has the molecular formula C23H26ClN3O3S and a molecular weight of 460.00 g/mol. Its IUPAC name is (3aR,4R,6R,7R,7aR)-N-benzyl-3-(3-chloro-4-methylphenyl)-6,7-dihydroxy-N-methyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide.
| Compound Name | (3aR,4R,6R,7R,7aR)-N-benzyl-3-(3-chloro-4-methylphenyl)-6,7-dihydroxy-N-methyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 40780786 |
| Molecular Formula | C23H26ClN3O3S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | (3aR,4R,6R,7R,7aR)-N-benzyl-3-(3-chloro-4-methylphenyl)-6,7-dihydroxy-N-methyl-2-sulfanylidene-3a,4,5,6,7,7a-hexahydro-1H-benzimidazole-4-carboxamide |
| SMILES | Cc1ccc(N2C(=S)N[C@H]3[C@@H](O)[C@H](O)C[C@@H](C(=O)N(C)Cc4ccccc4)[C@H]32)cc1Cl |
| InChI | InChI=1S/C23H26ClN3O3S/c1-13-8-9-15(10-17(13)24)27-20-16(11-18(28)21(29)19(20)25-23(27)31)22(30)26(2)12-14-6-4-3-5-7-14/h3-10,16,18-21,28-29H,11-12H2,1-2H3,(H,25,31)/t16-,18-,19-,20-,21+/m1/s1 |
| InChIKey | SBXDPTLZXNMUTA-MLZLACJZSA-N |
| XLogP | 2.48 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|