C27H20N2O5S — CID 40783229
(1S,11S,12R,16S)-14-(1,3-benzodioxol-5-ylmethyl)-11-(thiophene-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione (PubChem CID 40783229) has the molecular formula C27H20N2O5S and a molecular weight of 484.53 g/mol. Its IUPAC name is (1S,11S,12R,16S)-14-(1,3-benzodioxol-5-ylmethyl)-11-(thiophene-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione.
| Compound Name | (1S,11S,12R,16S)-14-(1,3-benzodioxol-5-ylmethyl)-11-(thiophene-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
|---|---|
| PubChem CID | 40783229 |
| Molecular Formula | C27H20N2O5S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | (1S,11S,12R,16S)-14-(1,3-benzodioxol-5-ylmethyl)-11-(thiophene-2-carbonyl)-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-13,15-dione |
| SMILES | O=C(c1cccs1)[C@@H]1[C@@H]2C(=O)N(Cc3ccc4c(c3)OCO4)C(=O)[C@@H]2[C@H]2c3ccccc3C=CN12 |
| InChI | InChI=1S/C27H20N2O5S/c30-25(20-6-3-11-35-20)24-22-21(23-17-5-2-1-4-16(17)9-10-28(23)24)26(31)29(27(22)32)13-15-7-8-18-19(12-15)34-14-33-18/h1-12,21-24H,13-14H2/t21-,22+,23+,24-/m0/s1 |
| InChIKey | RZXFEJQTFGXPQQ-KEZOAJOQSA-N |
| XLogP | 3.87 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|