C16H20N6O4S — CID 40785029
1-[[(2S)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]amino]-3-(4-methoxyphenyl)thiourea (PubChem CID 40785029) has the molecular formula C16H20N6O4S and a molecular weight of 392.44 g/mol. Its IUPAC name is 1-[[(2S)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]amino]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[[(2S)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]amino]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 40785029 |
| Molecular Formula | C16H20N6O4S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 1-[[(2S)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]amino]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NNC(=O)[C@H](C)n2nc(C)c([N+](=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C16H20N6O4S/c1-9-14(22(24)25)10(2)21(20-9)11(3)15(23)18-19-16(27)17-12-5-7-13(26-4)8-6-12/h5-8,11H,1-4H3,(H,18,23)(H2,17,19,27)/t11-/m0/s1 |
| InChIKey | CPUOGYZOOLSTPH-NSHDSACASA-N |
| XLogP | 2.00 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|