C15H17FN6O3S — CID 998599
1-[[(2R)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]amino]-3-(4-fluorophenyl)thiourea (PubChem CID 998599) has the molecular formula C15H17FN6O3S and a molecular weight of 380.41 g/mol. Its IUPAC name is 1-[[(2R)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]amino]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[[(2R)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]amino]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 998599 |
| Molecular Formula | C15H17FN6O3S |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-[[(2R)-2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoyl]amino]-3-(4-fluorophenyl)thiourea |
| SMILES | Cc1nn([C@H](C)C(=O)NNC(=S)Nc2ccc(F)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17FN6O3S/c1-8-13(22(24)25)9(2)21(20-8)10(3)14(23)18-19-15(26)17-12-6-4-11(16)5-7-12/h4-7,10H,1-3H3,(H,18,23)(H2,17,19,26)/t10-/m1/s1 |
| InChIKey | UQOBVZLSEJMLAI-SNVBAGLBSA-N |
| XLogP | 2.13 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|