C22H26N4O7S — CID 40786217
[(2R,4S)-4-hydroxy-1-(4-nitrophenyl)sulfonylpyrrolidin-2-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 40786217) has the molecular formula C22H26N4O7S and a molecular weight of 490.54 g/mol. Its IUPAC name is [(2R,4S)-4-hydroxy-1-(4-nitrophenyl)sulfonylpyrrolidin-2-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [(2R,4S)-4-hydroxy-1-(4-nitrophenyl)sulfonylpyrrolidin-2-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 40786217 |
| Molecular Formula | C22H26N4O7S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | [(2R,4S)-4-hydroxy-1-(4-nitrophenyl)sulfonylpyrrolidin-2-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)[C@H]3C[C@H](O)CN3S(=O)(=O)c3ccc([N+](=O)[O-])cc3)CC2)cc1 |
| InChI | InChI=1S/C22H26N4O7S/c1-33-19-6-2-16(3-7-19)23-10-12-24(13-11-23)22(28)21-14-18(27)15-25(21)34(31,32)20-8-4-17(5-9-20)26(29)30/h2-9,18,21,27H,10-15H2,1H3/t18-,21+/m0/s1 |
| InChIKey | WAXQLIVNBODIIL-GHTZIAJQSA-N |
| XLogP | 1.08 |
| TPSA | 133.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|