C26H25N5O7S — CID 42792998
1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-(4-nitrophenyl)sulfonylbenzimidazol-2-one (PubChem CID 42792998) has the molecular formula C26H25N5O7S and a molecular weight of 551.58 g/mol. Its IUPAC name is 1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-(4-nitrophenyl)sulfonylbenzimidazol-2-one.
| Compound Name | 1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-(4-nitrophenyl)sulfonylbenzimidazol-2-one |
|---|---|
| PubChem CID | 42792998 |
| Molecular Formula | C26H25N5O7S |
| Molecular Weight | 551.58 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 1-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]-3-(4-nitrophenyl)sulfonylbenzimidazol-2-one |
| SMILES | COc1ccc(N2CCN(C(=O)Cn3c(=O)n(S(=O)(=O)c4ccc([N+](=O)[O-])cc4)c4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C26H25N5O7S/c1-38-21-10-6-19(7-11-21)27-14-16-28(17-15-27)25(32)18-29-23-4-2-3-5-24(23)30(26(29)33)39(36,37)22-12-8-20(9-13-22)31(34)35/h2-13H,14-18H2,1H3 |
| InChIKey | YTINYSBUQPBERG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 136.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.58 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|