C26H25FN4O5S — CID 42792986
1-(4-fluorophenyl)sulfonyl-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]benzimidazol-2-one (PubChem CID 42792986) has the molecular formula C26H25FN4O5S and a molecular weight of 524.57 g/mol. Its IUPAC name is 1-(4-fluorophenyl)sulfonyl-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]benzimidazol-2-one.
| Compound Name | 1-(4-fluorophenyl)sulfonyl-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]benzimidazol-2-one |
|---|---|
| PubChem CID | 42792986 |
| Molecular Formula | C26H25FN4O5S |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 1-(4-fluorophenyl)sulfonyl-3-[2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-oxoethyl]benzimidazol-2-one |
| SMILES | COc1ccc(N2CCN(C(=O)Cn3c(=O)n(S(=O)(=O)c4ccc(F)cc4)c4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C26H25FN4O5S/c1-36-21-10-8-20(9-11-21)28-14-16-29(17-15-28)25(32)18-30-23-4-2-3-5-24(23)31(26(30)33)37(34,35)22-12-6-19(27)7-13-22/h2-13H,14-18H2,1H3 |
| InChIKey | MIRYIWDHAVOHFE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 93.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|