C22H22N4O5 — CID 46650973
methyl 1-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]indole-3-carboxylate (PubChem CID 46650973) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is methyl 1-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]indole-3-carboxylate.
| Compound Name | methyl 1-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 46650973 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | methyl 1-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]indole-3-carboxylate |
| SMILES | COC(=O)c1cn(CC(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)c2ccccc12 |
| InChI | InChI=1S/C22H22N4O5/c1-31-22(28)19-14-25(20-5-3-2-4-18(19)20)15-21(27)24-12-10-23(11-13-24)16-6-8-17(9-7-16)26(29)30/h2-9,14H,10-13,15H2,1H3 |
| InChIKey | NSKHRZXSJORPNS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 97.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|