C26H34ClN5O4 — CID 67665066
3-[1-(2-aminoethyl)indol-3-yl]oxy-1-[4-(4-nitrophenyl)piperazin-1-yl]hexan-1-one;hydrochloride (PubChem CID 67665066) has the molecular formula C26H34ClN5O4 and a molecular weight of 516.04 g/mol. Its IUPAC name is 3-[1-(2-aminoethyl)indol-3-yl]oxy-1-[4-(4-nitrophenyl)piperazin-1-yl]hexan-1-one;hydrochloride.
| Compound Name | 3-[1-(2-aminoethyl)indol-3-yl]oxy-1-[4-(4-nitrophenyl)piperazin-1-yl]hexan-1-one;hydrochloride |
|---|---|
| PubChem CID | 67665066 |
| Molecular Formula | C26H34ClN5O4 |
| Molecular Weight | 516.04 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | 3-[1-(2-aminoethyl)indol-3-yl]oxy-1-[4-(4-nitrophenyl)piperazin-1-yl]hexan-1-one;hydrochloride |
| SMILES | CCCC(CC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1)Oc1cn(CCN)c2ccccc12.Cl |
| InChI | InChI=1S/C26H33N5O4.ClH/c1-2-5-22(35-25-19-30(13-12-27)24-7-4-3-6-23(24)25)18-26(32)29-16-14-28(15-17-29)20-8-10-21(11-9-20)31(33)34;/h3-4,6-11,19,22H,2,5,12-18,27H2,1H3;1H |
| InChIKey | JHIARKDOCRJSMC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.04 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|